C12H17N3O4S — CID 139186922
[(2S,3S,5R)-3-amino-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 139186922) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is [(2S,3S,5R)-3-amino-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,5R)-3-amino-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139186922 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | [(2S,3S,5R)-3-amino-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=S)C[C@@H]1N |
| InChI | InChI=1S/C12H17N3O4S/c1-6-4-15(12(20)14-11(6)17)10-3-8(13)9(19-10)5-18-7(2)16/h4,8-10H,3,5,13H2,1-2H3,(H,14,17,20)/t8-,9+,10+/m0/s1 |
| InChIKey | GWXKJQUTHGAWOF-IVZWLZJFSA-N |
| XLogP | 0.39 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|