C11H15BN4O4 — CID 10265641
CID 10265641 (PubChem CID 10265641) has the molecular formula C11H15BN4O4 and a molecular weight of 278.08 g/mol.
| Compound Name | CID 10265641 |
|---|---|
| PubChem CID | 10265641 |
| Molecular Formula | C11H15BN4O4 |
| Molecular Weight | 278.08 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | — |
| SMILES | Cc1cn([C@H]2C[C@H](N)[C@@H](CO)O2)c(=O)[nH]c1=O.[B]C#N |
| InChI | InChI=1S/C10H15N3O4.CBN/c1-5-3-13(10(16)12-9(5)15)8-2-6(11)7(4-14)17-8;2-1-3/h3,6-8,14H,2,4,11H2,1H3,(H,12,15,16);/t6-,7+,8+;/m0./s1 |
| InChIKey | ZADPIAXEKLNLRA-HNPMAXIBSA-N |
| XLogP | -1.91 |
| TPSA | 134.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.08 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|