C13H17N3O5 — CID 69164526
3-[(2R,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxypropanenitrile (PubChem CID 69164526) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is 3-[(2R,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxypropanenitrile.
| Compound Name | 3-[(2R,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxypropanenitrile |
|---|---|
| PubChem CID | 69164526 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-[(2R,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxypropanenitrile |
| SMILES | Cc1cn([C@H]2CC(OCCC#N)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H17N3O5/c1-8-6-16(13(19)15-12(8)18)11-5-9(10(7-17)21-11)20-4-2-3-14/h6,9-11,17H,2,4-5,7H2,1H3,(H,15,18,19)/t9?,10-,11-/m1/s1 |
| InChIKey | AOAYCHXYSXQVPG-FHZGLPGMSA-N |
| XLogP | -0.58 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|