C13H19FN2O5 — CID 25032417
1-[(2S,4S,5S)-4-(3-fluoropropoxy)-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 25032417) has the molecular formula C13H19FN2O5 and a molecular weight of 302.30 g/mol. Its IUPAC name is 1-[(2S,4S,5S)-4-(3-fluoropropoxy)-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2S,4S,5S)-4-(3-fluoropropoxy)-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25032417 |
| Molecular Formula | C13H19FN2O5 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-[(2S,4S,5S)-4-(3-fluoropropoxy)-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2C[C@H](OCCCF)[C@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H19FN2O5/c1-8-6-16(13(19)15-12(8)18)11-5-9(10(7-17)21-11)20-4-2-3-14/h6,9-11,17H,2-5,7H2,1H3,(H,15,18,19)/t9-,10-,11-/m0/s1 |
| InChIKey | JGQKFPHFTKUMTR-DCAQKATOSA-N |
| XLogP | -0.13 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|