C18H30IN3O5 — CID 10005968
1-[(2R,4S,5R)-5-(hydroxymethyl)-4-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione iodide (PubChem CID 10005968) has the molecular formula C18H30IN3O5 and a molecular weight of 495.36 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-(hydroxymethyl)-4-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione iodide.
| Compound Name | 1-[(2R,4S,5R)-5-(hydroxymethyl)-4-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione iodide |
|---|---|
| PubChem CID | 10005968 |
| Molecular Formula | C18H30IN3O5 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 1-[(2R,4S,5R)-5-(hydroxymethyl)-4-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione iodide |
| SMILES | Cc1cn([C@H]2C[C@H](OCC[N+]3(C)CCCCC3)[C@@H](CO)O2)c(=O)[nH]c1=O.[I-] |
| InChI | InChI=1S/C18H29N3O5.HI/c1-13-11-20(18(24)19-17(13)23)16-10-14(15(12-22)26-16)25-9-8-21(2)6-4-3-5-7-21;/h11,14-16,22H,3-10,12H2,1-2H3;1H/t14-,15+,16+;/m0./s1 |
| InChIKey | RFYPQVFYVXVOKP-FUQNERGOSA-N |
| XLogP | -2.86 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|