C16H28N3O5+ — CID 10457362
3-[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxypropyl-trimethylazanium (PubChem CID 10457362) has the molecular formula C16H28N3O5+ and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxypropyl-trimethylazanium.
| Compound Name | 3-[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxypropyl-trimethylazanium |
|---|---|
| PubChem CID | 10457362 |
| Molecular Formula | C16H28N3O5+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 3-[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxypropyl-trimethylazanium |
| SMILES | Cc1cn([C@H]2C[C@H](OCCC[N+](C)(C)C)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H27N3O5/c1-11-9-18(16(22)17-15(11)21)14-8-12(13(10-20)24-14)23-7-5-6-19(2,3)4/h9,12-14,20H,5-8,10H2,1-4H3/p+1/t12-,13+,14+/m0/s1 |
| InChIKey | SENGYUWPQIRANQ-BFHYXJOUSA-O |
| XLogP | -0.39 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|