C13H20N2O6 — CID 175775727
1-[(2R,4S,5R)-5-(hydroxymethyl)-4-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 175775727) has the molecular formula C13H20N2O6 and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-(hydroxymethyl)-4-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-(hydroxymethyl)-4-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175775727 |
| Molecular Formula | C13H20N2O6 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-[(2R,4S,5R)-5-(hydroxymethyl)-4-(2-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COCCO[C@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C13H20N2O6/c1-8-6-15(13(18)14-12(8)17)11-5-9(10(7-16)21-11)20-4-3-19-2/h6,9-11,16H,3-5,7H2,1-2H3,(H,14,17,18)/t9-,10+,11+/m0/s1 |
| InChIKey | AOOMLYAJCIHXJJ-HBNTYKKESA-N |
| XLogP | -0.84 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|