C15H22N3O6P — CID 91426328
3-[ethyl-[2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyphosphanyl]oxypropanenitrile (PubChem CID 91426328) has the molecular formula C15H22N3O6P and a molecular weight of 371.33 g/mol. Its IUPAC name is 3-[ethyl-[2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyphosphanyl]oxypropanenitrile.
| Compound Name | 3-[ethyl-[2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 91426328 |
| Molecular Formula | C15H22N3O6P |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 3-[ethyl-[2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyphosphanyl]oxypropanenitrile |
| SMILES | CCP(OCCC#N)OC1CC(n2cc(C)c(=O)[nH]c2=O)OC1CO |
| InChI | InChI=1S/C15H22N3O6P/c1-3-25(22-6-4-5-16)24-11-7-13(23-12(11)9-19)18-8-10(2)14(20)17-15(18)21/h8,11-13,19H,3-4,6-7,9H2,1-2H3,(H,17,20,21) |
| InChIKey | KUHWWSYGFAUDKK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|