C19H30BrN4O5P — CID 121290959
3-[[(2S,3R,5R)-2-(bromomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 121290959) has the molecular formula C19H30BrN4O5P and a molecular weight of 505.35 g/mol. Its IUPAC name is 3-[[(2S,3R,5R)-2-(bromomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2S,3R,5R)-2-(bromomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 121290959 |
| Molecular Formula | C19H30BrN4O5P |
| Molecular Weight | 505.35 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 3-[[(2S,3R,5R)-2-(bromomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | Cc1cn([C@H]2C[C@@H](OP(OCCC#N)N(C(C)C)C(C)C)[C@@H](CBr)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H30BrN4O5P/c1-12(2)24(13(3)4)30(27-8-6-7-21)29-15-9-17(28-16(15)10-20)23-11-14(5)18(25)22-19(23)26/h11-13,15-17H,6,8-10H2,1-5H3,(H,22,25,26)/t15-,16-,17-,30?/m1/s1 |
| InChIKey | JRBYBFOAPHQSSQ-BJECGSRSSA-N |
| XLogP | 3.19 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|