C30H39N4O6P — CID 67653281
3-[[di(propan-2-yl)amino]-[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(naphthalen-2-ylmethoxymethyl)oxolan-3-yl]oxyphosphanyl]oxypropanenitrile (PubChem CID 67653281) has the molecular formula C30H39N4O6P and a molecular weight of 582.64 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(naphthalen-2-ylmethoxymethyl)oxolan-3-yl]oxyphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(naphthalen-2-ylmethoxymethyl)oxolan-3-yl]oxyphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 67653281 |
| Molecular Formula | C30H39N4O6P |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-(naphthalen-2-ylmethoxymethyl)oxolan-3-yl]oxyphosphanyl]oxypropanenitrile |
| SMILES | Cc1cn([C@H]2C[C@H](OP(OCCC#N)N(C(C)C)C(C)C)[C@@H](COCc3ccc4ccccc4c3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C30H39N4O6P/c1-20(2)34(21(3)4)41(38-14-8-13-31)40-26-16-28(33-17-22(5)29(35)32-30(33)36)39-27(26)19-37-18-23-11-12-24-9-6-7-10-25(24)15-23/h6-7,9-12,15,17,20-21,26-28H,8,14,16,18-19H2,1-5H3,(H,32,35,36)/t26-,27+,28+,41?/m0/s1 |
| InChIKey | BDZLVLTZBOGZBM-WQNBCVSBSA-N |
| XLogP | 5.16 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|