C21H33N4O5P — CID 134566919
3-[[di(propan-2-yl)amino]-[[(2S,6R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-yl]oxy]phosphanyl]oxypropanenitrile (PubChem CID 134566919) has the molecular formula C21H33N4O5P and a molecular weight of 452.49 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[[(2S,6R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-yl]oxy]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[[(2S,6R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-yl]oxy]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 134566919 |
| Molecular Formula | C21H33N4O5P |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[[(2S,6R)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-yl]oxy]phosphanyl]oxypropanenitrile |
| SMILES | Cc1cn([C@@H]2CC3CC[C@@H](OP(OCCC#N)N(C(C)C)C(C)C)C3O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H33N4O5P/c1-13(2)25(14(3)4)31(28-10-6-9-22)30-17-8-7-16-11-18(29-19(16)17)24-12-15(5)20(26)23-21(24)27/h12-14,16-19H,6-8,10-11H2,1-5H3,(H,23,26,27)/t16?,17-,18+,19?,31?/m1/s1 |
| InChIKey | KHBIXVNZGZGGGP-VPTMTIHBSA-N |
| XLogP | 3.20 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|