C23H35N4O5P — CID 89412016
3-[[di(propan-2-yl)amino]-[[(1R,2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-prop-2-ynoxycyclopentyl]methoxy]phosphanyl]oxypropanenitrile (PubChem CID 89412016) has the molecular formula C23H35N4O5P and a molecular weight of 478.53 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[[(1R,2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-prop-2-ynoxycyclopentyl]methoxy]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[[(1R,2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-prop-2-ynoxycyclopentyl]methoxy]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 89412016 |
| Molecular Formula | C23H35N4O5P |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[[(1R,2R,4R)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-prop-2-ynoxycyclopentyl]methoxy]phosphanyl]oxypropanenitrile |
| SMILES | C#CCO[C@@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1COP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C23H35N4O5P/c1-7-10-30-21-13-20(26-14-18(6)22(28)25-23(26)29)12-19(21)15-32-33(31-11-8-9-24)27(16(2)3)17(4)5/h1,14,16-17,19-21H,8,10-13,15H2,2-6H3,(H,25,28,29)/t19-,20-,21-,33?/m1/s1 |
| InChIKey | KKZWNYACUJXVRW-AJUJWGLRSA-N |
| XLogP | 3.11 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|