C27H41N4O9P — CID 59685276
1-O-[[(2R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 2-O-cyclohexyl oxalate (PubChem CID 59685276) has the molecular formula C27H41N4O9P and a molecular weight of 596.62 g/mol. Its IUPAC name is 1-O-[[(2R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 2-O-cyclohexyl oxalate.
| Compound Name | 1-O-[[(2R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 2-O-cyclohexyl oxalate |
|---|---|
| PubChem CID | 59685276 |
| Molecular Formula | C27H41N4O9P |
| Molecular Weight | 596.62 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | 1-O-[[(2R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 2-O-cyclohexyl oxalate |
| SMILES | Cc1cn([C@H]2CC(OP(OCCC#N)N(C(C)C)C(C)C)[C@@H](COC(=O)C(=O)OC3CCCCC3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C27H41N4O9P/c1-17(2)31(18(3)4)41(37-13-9-12-28)40-21-14-23(30-15-19(5)24(32)29-27(30)35)39-22(21)16-36-25(33)26(34)38-20-10-7-6-8-11-20/h15,17-18,20-23H,6-11,13-14,16H2,1-5H3,(H,29,32,35)/t21?,22-,23-,41?/m1/s1 |
| InChIKey | IVPOIAIHSNGSMM-LSJCOIQESA-N |
| XLogP | 3.21 |
| TPSA | 162.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|