C20H30FN4O7P — CID 71021999
[2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate (PubChem CID 71021999) has the molecular formula C20H30FN4O7P and a molecular weight of 488.45 g/mol. Its IUPAC name is [2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate.
| Compound Name | [2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 71021999 |
| Molecular Formula | C20H30FN4O7P |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1CC(n2cc(F)c(=O)[nH]c2=O)OC1COP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C20H30FN4O7P/c1-12(2)25(13(3)4)33(29-8-6-7-22)30-11-17-16(31-14(5)26)9-18(32-17)24-10-15(21)19(27)23-20(24)28/h10,12-13,16-18H,6,8-9,11H2,1-5H3,(H,23,27,28) |
| InChIKey | PHIHLLQULJUFTC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|