C22H33N4O9P — CID 164665559
[4-acetyloxy-2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate (PubChem CID 164665559) has the molecular formula C22H33N4O9P and a molecular weight of 528.50 g/mol. Its IUPAC name is [4-acetyloxy-2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate.
| Compound Name | [4-acetyloxy-2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 164665559 |
| Molecular Formula | C22H33N4O9P |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | [4-acetyloxy-2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1C(COP(OCCC#N)N(C(C)C)C(C)C)OC(n2ccc(=O)[nH]c2=O)C1OC(C)=O |
| InChI | InChI=1S/C22H33N4O9P/c1-13(2)26(14(3)4)36(31-11-7-9-23)32-12-17-19(33-15(5)27)20(34-16(6)28)21(35-17)25-10-8-18(29)24-22(25)30/h8,10,13-14,17,19-21H,7,11-12H2,1-6H3,(H,24,29,30) |
| InChIKey | QUNYGIBAHMVXKK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 162.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|