C24H37N4O8P — CID 71028552
[(2R,3R,5R)-2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 4-oxopentanoate (PubChem CID 71028552) has the molecular formula C24H37N4O8P and a molecular weight of 540.55 g/mol. Its IUPAC name is [(2R,3R,5R)-2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 4-oxopentanoate.
| Compound Name | [(2R,3R,5R)-2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 71028552 |
| Molecular Formula | C24H37N4O8P |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | [(2R,3R,5R)-2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)O[C@@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1COP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C24H37N4O8P/c1-15(2)28(16(3)4)37(33-11-7-10-25)34-14-20-19(36-22(30)9-8-18(6)29)12-21(35-20)27-13-17(5)23(31)26-24(27)32/h13,15-16,19-21H,7-9,11-12,14H2,1-6H3,(H,26,31,32)/t19-,20-,21-,37?/m1/s1 |
| InChIKey | OUHFIHJVKZVBOM-KGTCALOMSA-N |
| XLogP | 2.71 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|