C34H38N5O9P — CID 59685278
1-O-[[(2R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 2-O-(2-cyanophenyl) benzene-1,2-dicarboxylate (PubChem CID 59685278) has the molecular formula C34H38N5O9P and a molecular weight of 691.68 g/mol. Its IUPAC name is 1-O-[[(2R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 2-O-(2-cyanophenyl) benzene-1,2-dicarboxylate.
| Compound Name | 1-O-[[(2R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 2-O-(2-cyanophenyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59685278 |
| Molecular Formula | C34H38N5O9P |
| Molecular Weight | 691.68 g/mol |
| Exact Mass | 691.24 |
| IUPAC Name | 1-O-[[(2R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 2-O-(2-cyanophenyl) benzene-1,2-dicarboxylate |
| SMILES | Cc1cn([C@H]2CC(OP(OCCC#N)N(C(C)C)C(C)C)[C@@H](COC(=O)c3ccccc3C(=O)Oc3ccccc3C#N)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C34H38N5O9P/c1-21(2)39(22(3)4)49(45-16-10-15-35)48-28-17-30(38-19-23(5)31(40)37-34(38)43)46-29(28)20-44-32(41)25-12-7-8-13-26(25)33(42)47-27-14-9-6-11-24(27)18-36/h6-9,11-14,19,21-22,28-30H,10,16-17,20H2,1-5H3,(H,37,40,43)/t28?,29-,30-,49?/m1/s1 |
| InChIKey | NZQZMXJKZLCFBR-RJMSBTFNSA-N |
| XLogP | 4.74 |
| TPSA | 185.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|