C25H34N5O6P — CID 69460449
[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]methyl benzoate (PubChem CID 69460449) has the molecular formula C25H34N5O6P and a molecular weight of 531.55 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 69460449 |
| Molecular Formula | C25H34N5O6P |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]methyl benzoate |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)O[C@H]1C[C@H](n2ccc(N)nc2=O)O[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H34N5O6P/c1-17(2)30(18(3)4)37(34-14-8-12-26)36-20-15-23(29-13-11-22(27)28-25(29)32)35-21(20)16-33-24(31)19-9-6-5-7-10-19/h5-7,9-11,13,17-18,20-21,23H,8,14-16H2,1-4H3,(H2,27,28,32)/t20-,21+,23+,37?/m0/s1 |
| InChIKey | IMNUTFQKHSMXHD-ARQZUEEYSA-N |
| XLogP | 3.63 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|