C25H32N5O5P — CID 139505902
N-[1-[(1S,3R)-6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-oxabicyclo[3.1.0]hexan-3-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 139505902) has the molecular formula C25H32N5O5P and a molecular weight of 513.54 g/mol. Its IUPAC name is N-[1-[(1S,3R)-6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-oxabicyclo[3.1.0]hexan-3-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(1S,3R)-6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-oxabicyclo[3.1.0]hexan-3-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 139505902 |
| Molecular Formula | C25H32N5O5P |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | N-[1-[(1S,3R)-6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-oxabicyclo[3.1.0]hexan-3-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C2C[C@H](n3ccc(NC(=O)c4ccccc4)nc3=O)O[C@@H]21 |
| InChI | InChI=1S/C25H32N5O5P/c1-16(2)30(17(3)4)36(33-14-8-12-26)35-23-19-15-21(34-22(19)23)29-13-11-20(28-25(29)32)27-24(31)18-9-6-5-7-10-18/h5-7,9-11,13,16-17,19,21-23H,8,14-15H2,1-4H3,(H,27,28,31,32)/t19?,21-,22+,23?,36?/m1/s1 |
| InChIKey | LSIRBWQAIKXEEY-IOINTJLISA-N |
| XLogP | 4.07 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|