C27H38N5O6P — CID 170290421
N-[1-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-ethyl-3-methoxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 170290421) has the molecular formula C27H38N5O6P and a molecular weight of 559.60 g/mol. Its IUPAC name is N-[1-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-ethyl-3-methoxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-ethyl-3-methoxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 170290421 |
| Molecular Formula | C27H38N5O6P |
| Molecular Weight | 559.60 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | N-[1-[(2R,3R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-ethyl-3-methoxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CC[C@H]1O[C@@H](n2ccc(NC(=O)c3ccccc3)nc2=O)[C@H](OC)[C@@H]1OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C27H38N5O6P/c1-7-21-23(38-39(36-17-11-15-28)32(18(2)3)19(4)5)24(35-6)26(37-21)31-16-14-22(30-27(31)34)29-25(33)20-12-9-8-10-13-20/h8-10,12-14,16,18-19,21,23-24,26H,7,11,17H2,1-6H3,(H,29,30,33,34)/t21-,23-,24-,26-,39?/m1/s1 |
| InChIKey | SLMMGADGPHJFKZ-SNWGJHAESA-N |
| XLogP | 4.48 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|