C26H34F2N5O5P — CID 160549489
N-[1-[(2R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-ethyl-3,3-difluorooxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 160549489) has the molecular formula C26H34F2N5O5P and a molecular weight of 565.56 g/mol. Its IUPAC name is N-[1-[(2R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-ethyl-3,3-difluorooxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-ethyl-3,3-difluorooxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 160549489 |
| Molecular Formula | C26H34F2N5O5P |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | N-[1-[(2R,4R,5R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-ethyl-3,3-difluorooxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CC[C@H]1O[C@@H](n2ccc(NC(=O)c3ccccc3)nc2=O)C(F)(F)[C@@H]1OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C26H34F2N5O5P/c1-6-20-22(38-39(36-16-10-14-29)33(17(2)3)18(4)5)26(27,28)24(37-20)32-15-13-21(31-25(32)35)30-23(34)19-11-8-7-9-12-19/h7-9,11-13,15,17-18,20,22,24H,6,10,16H2,1-5H3,(H,30,31,34,35)/t20-,22-,24-,39?/m1/s1 |
| InChIKey | QXWHHBVWBRUTFN-JTQGBDAJSA-N |
| XLogP | 5.10 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|