C25H33N6O8P — CID 10907962
[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]methyl 4-nitrobenzoate (PubChem CID 10907962) has the molecular formula C25H33N6O8P and a molecular weight of 576.55 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]methyl 4-nitrobenzoate.
| Compound Name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 10907962 |
| Molecular Formula | C25H33N6O8P |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]methyl 4-nitrobenzoate |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)O[C@H]1C[C@H](n2ccc(N)nc2=O)O[C@@H]1COC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H33N6O8P/c1-16(2)30(17(3)4)40(37-13-5-11-26)39-20-14-23(29-12-10-22(27)28-25(29)33)38-21(20)15-36-24(32)18-6-8-19(9-7-18)31(34)35/h6-10,12,16-17,20-21,23H,5,13-15H2,1-4H3,(H2,27,28,33)/t20-,21+,23+,40?/m0/s1 |
| InChIKey | FPFYYEQNLDSUFV-YKYLQDKNSA-N |
| XLogP | 3.54 |
| TPSA | 185.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|