C13H17FN2O6S — CID 10337789
[(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(methylsulfanylmethoxymethyl)oxolan-3-yl] acetate (PubChem CID 10337789) has the molecular formula C13H17FN2O6S and a molecular weight of 348.35 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(methylsulfanylmethoxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(methylsulfanylmethoxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 10337789 |
| Molecular Formula | C13H17FN2O6S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(methylsulfanylmethoxymethyl)oxolan-3-yl] acetate |
| SMILES | CSCOC[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H17FN2O6S/c1-7(17)21-9-3-11(22-10(9)5-20-6-23-2)16-4-8(14)12(18)15-13(16)19/h4,9-11H,3,5-6H2,1-2H3,(H,15,18,19)/t9-,10+,11+/m0/s1 |
| InChIKey | NILKZMOSDRZVEA-HBNTYKKESA-N |
| XLogP | 0.23 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|