C24H42N3O7PS — CID 91397501
S-[2-[2-[[di(propan-2-yl)amino]-[2-ethyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyphosphanyl]oxyethoxy]ethyl] propanethioate (PubChem CID 91397501) has the molecular formula C24H42N3O7PS and a molecular weight of 547.66 g/mol. Its IUPAC name is S-[2-[2-[[di(propan-2-yl)amino]-[2-ethyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyphosphanyl]oxyethoxy]ethyl] propanethioate.
| Compound Name | S-[2-[2-[[di(propan-2-yl)amino]-[2-ethyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyphosphanyl]oxyethoxy]ethyl] propanethioate |
|---|---|
| PubChem CID | 91397501 |
| Molecular Formula | C24H42N3O7PS |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | S-[2-[2-[[di(propan-2-yl)amino]-[2-ethyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyphosphanyl]oxyethoxy]ethyl] propanethioate |
| SMILES | CCC(=O)SCCOCCOP(OC1CC(n2cc(C)c(=O)[nH]c2=O)OC1CC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C24H42N3O7PS/c1-8-19-20(14-21(33-19)26-15-18(7)23(29)25-24(26)30)34-35(27(16(3)4)17(5)6)32-11-10-31-12-13-36-22(28)9-2/h15-17,19-21H,8-14H2,1-7H3,(H,25,29,30) |
| InChIKey | LCBDGWCBYILEPB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|