C27H41N4O6P — CID 157096399
3-[[(2R,3R,5R)-2-(deuteriooxymethyl)-5-(5-octa-1,7-diynyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile;tritiomethane (PubChem CID 157096399) has the molecular formula C27H41N4O6P and a molecular weight of 551.64 g/mol. Its IUPAC name is 3-[[(2R,3R,5R)-2-(deuteriooxymethyl)-5-(5-octa-1,7-diynyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile;tritiomethane.
| Compound Name | 3-[[(2R,3R,5R)-2-(deuteriooxymethyl)-5-(5-octa-1,7-diynyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile;tritiomethane |
|---|---|
| PubChem CID | 157096399 |
| Molecular Formula | C27H41N4O6P |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | 3-[[(2R,3R,5R)-2-(deuteriooxymethyl)-5-(5-octa-1,7-diynyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile;tritiomethane |
| SMILES | [2H]OC[C@H]1O[C@@H](n2cc(C#CCCCCC#C)c(=O)[nH]c2=O)C[C@H]1OP(OCCC#N)N(C(C)C)C(C)C.[3H]C |
| InChI | InChI=1S/C26H37N4O6P.CH4/c1-6-7-8-9-10-11-13-21-17-29(26(33)28-25(21)32)24-16-22(23(18-31)35-24)36-37(34-15-12-14-27)30(19(2)3)20(4)5;/h1,17,19-20,22-24,31H,7-10,12,15-16,18H2,2-5H3,(H,28,32,33);1H4/t22-,23-,24-,37?;/m1./s1/i31D;1T |
| InChIKey | AFGKBNWXUPZJGI-UPVUYQCXSA-N |
| XLogP | 3.66 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|