C20H21N5O7 — CID 155054014
[(2S,4R,5R)-4-acetyloxy-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 155054014) has the molecular formula C20H21N5O7 and a molecular weight of 443.42 g/mol. Its IUPAC name is [(2S,4R,5R)-4-acetyloxy-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2S,4R,5R)-4-acetyloxy-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 155054014 |
| Molecular Formula | C20H21N5O7 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [(2S,4R,5R)-4-acetyloxy-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | CC(=O)O[C@@H]1C(N=[N+]=[N-])[C@@H](COC(=O)c2ccc(C)cc2)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H21N5O7/c1-10-4-6-13(7-5-10)19(28)30-9-14-15(23-24-21)16(31-12(3)26)18(32-14)25-8-11(2)17(27)22-20(25)29/h4-8,14-16,18H,9H2,1-3H3,(H,22,27,29)/t14-,15?,16-,18-/m1/s1 |
| InChIKey | MXBYYMOSCKIJPK-ZXWBDNALSA-N |
| XLogP | 1.52 |
| TPSA | 165.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|