C25H29N5O8 — CID 134512032
[(2S,4R,5R)-3-azido-4-ethoxy-5-[3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-5-methyl-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 134512032) has the molecular formula C25H29N5O8 and a molecular weight of 527.53 g/mol. Its IUPAC name is [(2S,4R,5R)-3-azido-4-ethoxy-5-[3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-5-methyl-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2S,4R,5R)-3-azido-4-ethoxy-5-[3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-5-methyl-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 134512032 |
| Molecular Formula | C25H29N5O8 |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | [(2S,4R,5R)-3-azido-4-ethoxy-5-[3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-5-methyl-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | CCOC(=O)/C=C/n1c(=O)c(C)cn([C@@H]2O[C@H](COC(=O)c3ccc(C)cc3)C(N=[N+]=[N-])[C@H]2OCC)c1=O |
| InChI | InChI=1S/C25H29N5O8/c1-5-35-19(31)11-12-29-22(32)16(4)13-30(25(29)34)23-21(36-6-2)20(27-28-26)18(38-23)14-37-24(33)17-9-7-15(3)8-10-17/h7-13,18,20-21,23H,5-6,14H2,1-4H3/b12-11+/t18-,20?,21-,23-/m1/s1 |
| InChIKey | JAZVVDGPVBANCA-JNUYUVFISA-N |
| XLogP | 2.50 |
| TPSA | 163.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|