C13H19N5O5 — CID 134507582
1-[(2R,3R,4R,5R)-4-azido-5-ethyl-3-(2-methoxyethoxy)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 134507582) has the molecular formula C13H19N5O5 and a molecular weight of 325.33 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-4-azido-5-ethyl-3-(2-methoxyethoxy)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-4-azido-5-ethyl-3-(2-methoxyethoxy)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134507582 |
| Molecular Formula | C13H19N5O5 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-4-azido-5-ethyl-3-(2-methoxyethoxy)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](OCCOC)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C13H19N5O5/c1-3-8-10(16-17-14)11(22-7-6-21-2)12(23-8)18-5-4-9(19)15-13(18)20/h4-5,8,10-12H,3,6-7H2,1-2H3,(H,15,19,20)/t8-,10-,11-,12-/m1/s1 |
| InChIKey | RMXQUIOBGSJNPN-HJQYOEGKSA-N |
| XLogP | 0.55 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|