C18H18N6O6 — CID 15755572
[(2R,3S,4R,5R)-4-azido-5-(benzamidomethyl)-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate (PubChem CID 15755572) has the molecular formula C18H18N6O6 and a molecular weight of 414.38 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-azido-5-(benzamidomethyl)-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R)-4-azido-5-(benzamidomethyl)-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 15755572 |
| Molecular Formula | C18H18N6O6 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | [(2R,3S,4R,5R)-4-azido-5-(benzamidomethyl)-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](N=[N+]=[N-])[C@@H](CNC(=O)c2ccccc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C18H18N6O6/c1-10(25)29-15-14(22-23-19)12(9-20-16(27)11-5-3-2-4-6-11)30-17(15)24-8-7-13(26)21-18(24)28/h2-8,12,14-15,17H,9H2,1H3,(H,20,27)(H,21,26,28)/t12-,14-,15+,17-/m1/s1 |
| InChIKey | GORKXBKLEYRHSH-JJAZEVLHSA-N |
| XLogP | 0.47 |
| TPSA | 168.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|