C26H23N5O8 — CID 20823702
[5-azido-3-benzoyloxy-2-(2,4-dioxopyrimidin-1-yl)-6-propanoyloxan-4-yl] benzoate (PubChem CID 20823702) has the molecular formula C26H23N5O8 and a molecular weight of 533.50 g/mol. Its IUPAC name is [5-azido-3-benzoyloxy-2-(2,4-dioxopyrimidin-1-yl)-6-propanoyloxan-4-yl] benzoate.
| Compound Name | [5-azido-3-benzoyloxy-2-(2,4-dioxopyrimidin-1-yl)-6-propanoyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 20823702 |
| Molecular Formula | C26H23N5O8 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | [5-azido-3-benzoyloxy-2-(2,4-dioxopyrimidin-1-yl)-6-propanoyloxan-4-yl] benzoate |
| SMILES | CCC(=O)C1OC(n2ccc(=O)[nH]c2=O)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1N=[N+]=[N-] |
| InChI | InChI=1S/C26H23N5O8/c1-2-17(32)20-19(29-30-27)21(38-24(34)15-9-5-3-6-10-15)22(39-25(35)16-11-7-4-8-12-16)23(37-20)31-14-13-18(33)28-26(31)36/h3-14,19-23H,2H2,1H3,(H,28,33,36) |
| InChIKey | NJNMRKFVVOLCEM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 182.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|