C23H18FIN2O7 — CID 90254272
[(2R,3R,4S,5R)-4-benzoyloxy-2-(2,4-dioxopyrimidin-1-yl)-5-fluoro-5-(iodomethyl)oxolan-3-yl] benzoate (PubChem CID 90254272) has the molecular formula C23H18FIN2O7 and a molecular weight of 580.31 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4-benzoyloxy-2-(2,4-dioxopyrimidin-1-yl)-5-fluoro-5-(iodomethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R)-4-benzoyloxy-2-(2,4-dioxopyrimidin-1-yl)-5-fluoro-5-(iodomethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 90254272 |
| Molecular Formula | C23H18FIN2O7 |
| Molecular Weight | 580.31 g/mol |
| Exact Mass | 580.01 |
| IUPAC Name | [(2R,3R,4S,5R)-4-benzoyloxy-2-(2,4-dioxopyrimidin-1-yl)-5-fluoro-5-(iodomethyl)oxolan-3-yl] benzoate |
| SMILES | O=C(O[C@H]1[C@H](n2ccc(=O)[nH]c2=O)O[C@](F)(CI)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H18FIN2O7/c24-23(13-25)18(33-21(30)15-9-5-2-6-10-15)17(32-20(29)14-7-3-1-4-8-14)19(34-23)27-12-11-16(28)26-22(27)31/h1-12,17-19H,13H2,(H,26,28,31)/t17-,18+,19-,23-/m1/s1 |
| InChIKey | XLHOZZITQUEJDY-ISJRUSPKSA-N |
| XLogP | 2.62 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|