C24H19F2IN2O7 — CID 90248174
[(2R,3S,4R,5R)-4-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-4-(fluoromethyl)-2-(iodomethyl)oxolan-3-yl] benzoate (PubChem CID 90248174) has the molecular formula C24H19F2IN2O7 and a molecular weight of 612.32 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-4-(fluoromethyl)-2-(iodomethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R)-4-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-4-(fluoromethyl)-2-(iodomethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 90248174 |
| Molecular Formula | C24H19F2IN2O7 |
| Molecular Weight | 612.32 g/mol |
| Exact Mass | 612.02 |
| IUPAC Name | [(2R,3S,4R,5R)-4-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-4-(fluoromethyl)-2-(iodomethyl)oxolan-3-yl] benzoate |
| SMILES | O=C(O[C@H]1[C@@](CF)(OC(=O)c2ccccc2)[C@H](n2ccc(=O)[nH]c2=O)O[C@]1(F)CI)c1ccccc1 |
| InChI | InChI=1S/C24H19F2IN2O7/c25-13-23(35-19(32)16-9-5-2-6-10-16)20(34-18(31)15-7-3-1-4-8-15)24(26,14-27)36-21(23)29-12-11-17(30)28-22(29)33/h1-12,20-21H,13-14H2,(H,28,30,33)/t20-,21+,23+,24+/m0/s1 |
| InChIKey | KMUZGCTYGNIBKV-XWVZOOPGSA-N |
| XLogP | 2.96 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|