C31H26N2O9 — CID 70914983
[(2R,3R,4R)-3,4-dibenzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 70914983) has the molecular formula C31H26N2O9 and a molecular weight of 570.55 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-dibenzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R)-3,4-dibenzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 70914983 |
| Molecular Formula | C31H26N2O9 |
| Molecular Weight | 570.55 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | [(2R,3R,4R)-3,4-dibenzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@]1(OC(=O)c2ccccc2)C(n2ccc(=O)[nH]c2=O)O[C@H](COC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H26N2O9/c1-31(42-28(37)22-15-9-4-10-16-22)25(41-27(36)21-13-7-3-8-14-21)23(19-39-26(35)20-11-5-2-6-12-20)40-29(31)33-18-17-24(34)32-30(33)38/h2-18,23,25,29H,19H2,1H3,(H,32,34,38)/t23-,25-,29?,31-/m1/s1 |
| InChIKey | MEWJCEWIFZELKA-DYMFHWBKSA-N |
| XLogP | 3.13 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|