C34H29N5O9 — CID 137216248
[(2R,4R,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-3,4-dibenzoyloxy-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 137216248) has the molecular formula C34H29N5O9 and a molecular weight of 651.63 g/mol. Its IUPAC name is [(2R,4R,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-3,4-dibenzoyloxy-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,4R,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-3,4-dibenzoyloxy-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 137216248 |
| Molecular Formula | C34H29N5O9 |
| Molecular Weight | 651.63 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | [(2R,4R,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-3,4-dibenzoyloxy-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)Nc1nc2c(ncn2[C@@H]2O[C@H](COC(=O)c3ccccc3)C(OC(=O)c3ccccc3)[C@@]2(C)OC(=O)c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C34H29N5O9/c1-20(40)36-33-37-27-25(28(41)38-33)35-19-39(27)32-34(2,48-31(44)23-16-10-5-11-17-23)26(47-30(43)22-14-8-4-9-15-22)24(46-32)18-45-29(42)21-12-6-3-7-13-21/h3-17,19,24,26,32H,18H2,1-2H3,(H2,36,37,38,40,41)/t24-,26?,32-,34-/m1/s1 |
| InChIKey | PYNJSQLPBBLTIR-HKLDIMADSA-N |
| XLogP | 3.67 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.63 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|