C32H25N3O9S — CID 136624123
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 136624123) has the molecular formula C32H25N3O9S and a molecular weight of 627.63 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 136624123 |
| Molecular Formula | C32H25N3O9S |
| Molecular Weight | 627.63 g/mol |
| Exact Mass | 627.13 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@@]1(OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O[C@H]1n1c(=O)sc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C32H25N3O9S/c1-32(44-29(39)21-15-9-4-10-16-21)24(43-28(38)20-13-7-3-8-14-20)22(17-41-27(37)19-11-5-2-6-12-19)42-30(32)35-25-23(45-31(35)40)26(36)34-18-33-25/h2-16,18,22,24,30H,17H2,1H3,(H,33,34,36)/t22-,24-,30-,32-/m1/s1 |
| InChIKey | NRVCAIFHDJGOTK-ZLZVUVTQSA-N |
| XLogP | 3.74 |
| TPSA | 155.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|