C33H30N2O8 — CID 124869792
[(2S,3R,4S,5R)-3,4-dibenzoyloxy-5-(3-carbamoyl-4H-pyridin-1-yl)-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 124869792) has the molecular formula C33H30N2O8 and a molecular weight of 582.61 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3,4-dibenzoyloxy-5-(3-carbamoyl-4H-pyridin-1-yl)-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,4S,5R)-3,4-dibenzoyloxy-5-(3-carbamoyl-4H-pyridin-1-yl)-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 124869792 |
| Molecular Formula | C33H30N2O8 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | [(2S,3R,4S,5R)-3,4-dibenzoyloxy-5-(3-carbamoyl-4H-pyridin-1-yl)-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@]1(OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H](COC(=O)c2ccccc2)O[C@H]1N1C=CCC(C(N)=O)=C1 |
| InChI | InChI=1S/C33H30N2O8/c1-33(43-31(39)24-16-9-4-10-17-24)27(42-30(38)23-14-7-3-8-15-23)26(21-40-29(37)22-12-5-2-6-13-22)41-32(33)35-19-11-18-25(20-35)28(34)36/h2-17,19-20,26-27,32H,18,21H2,1H3,(H2,34,36)/t26-,27+,32+,33-/m0/s1 |
| InChIKey | VUXPYRXHACFVRS-CSKDIPCXSA-N |
| XLogP | 4.00 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|