C35H32N6O7 — CID 66804722
[(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-3,4-dibenzoyloxy-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 66804722) has the molecular formula C35H32N6O7 and a molecular weight of 648.68 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-3,4-dibenzoyloxy-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-3,4-dibenzoyloxy-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 66804722 |
| Molecular Formula | C35H32N6O7 |
| Molecular Weight | 648.68 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-3,4-dibenzoyloxy-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@@]1(OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O[C@H]1n1cnc2c(NC3CC3)nc(N)nc21 |
| InChI | InChI=1S/C35H32N6O7/c1-35(48-32(44)23-15-9-4-10-16-23)27(47-31(43)22-13-7-3-8-14-22)25(19-45-30(42)21-11-5-2-6-12-21)46-33(35)41-20-37-26-28(38-24-17-18-24)39-34(36)40-29(26)41/h2-16,20,24-25,27,33H,17-19H2,1H3,(H3,36,38,39,40)/t25-,27-,33-,35-/m1/s1 |
| InChIKey | IFTLUNAFXCWUQD-JCPJWVNKSA-N |
| XLogP | 4.58 |
| TPSA | 169.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|