C33H28ClN5O7 — CID 134349072
[(2R,3S,4R,5R)-5-(2-amino-6-chloropurin-9-yl)-3-benzoyloxy-4-(benzoyloxymethyl)-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 134349072) has the molecular formula C33H28ClN5O7 and a molecular weight of 642.07 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-amino-6-chloropurin-9-yl)-3-benzoyloxy-4-(benzoyloxymethyl)-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5R)-5-(2-amino-6-chloropurin-9-yl)-3-benzoyloxy-4-(benzoyloxymethyl)-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 134349072 |
| Molecular Formula | C33H28ClN5O7 |
| Molecular Weight | 642.07 g/mol |
| Exact Mass | 641.17 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-amino-6-chloropurin-9-yl)-3-benzoyloxy-4-(benzoyloxymethyl)-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@@]1(COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O[C@H]1n1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C33H28ClN5O7/c1-33(18-44-29(41)21-13-7-3-8-14-21)25(46-30(42)22-15-9-4-10-16-22)23(17-43-28(40)20-11-5-2-6-12-20)45-31(33)39-19-36-24-26(34)37-32(35)38-27(24)39/h2-16,19,23,25,31H,17-18H2,1H3,(H2,35,37,38)/t23-,25-,31-,33-/m1/s1 |
| InChIKey | WGSYOUBBHPLUFO-MAKQACHMSA-N |
| XLogP | 4.91 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.07 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|