C25H20ClN7O5 — CID 90448694
[(2R,3S,4R)-4-azido-3-benzoyloxy-5-(6-chloropurin-9-yl)-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 90448694) has the molecular formula C25H20ClN7O5 and a molecular weight of 533.93 g/mol. Its IUPAC name is [(2R,3S,4R)-4-azido-3-benzoyloxy-5-(6-chloropurin-9-yl)-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R)-4-azido-3-benzoyloxy-5-(6-chloropurin-9-yl)-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 90448694 |
| Molecular Formula | C25H20ClN7O5 |
| Molecular Weight | 533.93 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | [(2R,3S,4R)-4-azido-3-benzoyloxy-5-(6-chloropurin-9-yl)-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@]1(N=[N+]=[N-])C(n2cnc3c(Cl)ncnc32)O[C@H](COC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20ClN7O5/c1-25(31-32-27)19(38-23(35)16-10-6-3-7-11-16)17(12-36-22(34)15-8-4-2-5-9-15)37-24(25)33-14-30-18-20(26)28-13-29-21(18)33/h2-11,13-14,17,19,24H,12H2,1H3/t17-,19-,24?,25-/m1/s1 |
| InChIKey | BWOIDYRSRBCPPZ-OLLVUZKISA-N |
| XLogP | 4.53 |
| TPSA | 154.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.93 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|