C19H16ClN7O6 — CID 11038066
[(2R,3R,4R,5S)-4-azido-2-(6-chloropurin-9-yl)-5-(methoxycarbonyloxymethyl)oxolan-3-yl] benzoate (PubChem CID 11038066) has the molecular formula C19H16ClN7O6 and a molecular weight of 473.83 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-4-azido-2-(6-chloropurin-9-yl)-5-(methoxycarbonyloxymethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5S)-4-azido-2-(6-chloropurin-9-yl)-5-(methoxycarbonyloxymethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 11038066 |
| Molecular Formula | C19H16ClN7O6 |
| Molecular Weight | 473.83 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | [(2R,3R,4R,5S)-4-azido-2-(6-chloropurin-9-yl)-5-(methoxycarbonyloxymethyl)oxolan-3-yl] benzoate |
| SMILES | COC(=O)OC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)[C@H](OC(=O)c2ccccc2)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C19H16ClN7O6/c1-30-19(29)31-7-11-12(25-26-21)14(33-18(28)10-5-3-2-4-6-10)17(32-11)27-9-24-13-15(20)22-8-23-16(13)27/h2-6,8-9,11-12,14,17H,7H2,1H3/t11-,12-,14-,17-/m1/s1 |
| InChIKey | BJVXGBJJXMDJLM-CTWCOEIASA-N |
| XLogP | 3.06 |
| TPSA | 163.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.83 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|