C32H26N4O8 — CID 15115667
[(2R,3R,4S,5R)-3,4-dibenzoyloxy-5-(6-methoxypurin-9-yl)oxolan-2-yl]methyl benzoate (PubChem CID 15115667) has the molecular formula C32H26N4O8 and a molecular weight of 594.58 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4-dibenzoyloxy-5-(6-methoxypurin-9-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R)-3,4-dibenzoyloxy-5-(6-methoxypurin-9-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 15115667 |
| Molecular Formula | C32H26N4O8 |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4-dibenzoyloxy-5-(6-methoxypurin-9-yl)oxolan-2-yl]methyl benzoate |
| SMILES | COc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H26N4O8/c1-40-28-24-27(33-18-34-28)36(19-35-24)29-26(44-32(39)22-15-9-4-10-16-22)25(43-31(38)21-13-7-3-8-14-21)23(42-29)17-41-30(37)20-11-5-2-6-12-20/h2-16,18-19,23,25-26,29H,17H2,1H3/t23-,25-,26+,29-/m1/s1 |
| InChIKey | WSCAFXARAHJOHP-JAVQUFKRSA-N |
| XLogP | 4.04 |
| TPSA | 140.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|