C31H24N4O7 — CID 169099092
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6-deuteriopurin-9-yl)oxolan-2-yl]methyl benzoate (PubChem CID 169099092) has the molecular formula C31H24N4O7 and a molecular weight of 565.56 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6-deuteriopurin-9-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6-deuteriopurin-9-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 169099092 |
| Molecular Formula | C31H24N4O7 |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(6-deuteriopurin-9-yl)oxolan-2-yl]methyl benzoate |
| SMILES | [2H]c1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H24N4O7/c36-29(20-10-4-1-5-11-20)39-17-24-25(41-30(37)21-12-6-2-7-13-21)26(42-31(38)22-14-8-3-9-15-22)28(40-24)35-19-34-23-16-32-18-33-27(23)35/h1-16,18-19,24-26,28H,17H2/t24-,25-,26-,28-/m1/s1/i16D |
| InChIKey | DPDRXTDNHQNYSP-VZKMDADISA-N |
| XLogP | 4.03 |
| TPSA | 131.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|