C31H24N4O8 — CID 136690084
[(2R,3S,4S,5R)-3,4-dibenzoyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl benzoate (PubChem CID 136690084) has the molecular formula C31H24N4O8 and a molecular weight of 580.55 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4-dibenzoyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R)-3,4-dibenzoyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 136690084 |
| Molecular Formula | C31H24N4O8 |
| Molecular Weight | 580.55 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4-dibenzoyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]cnc32)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H24N4O8/c36-27-23-26(32-17-33-27)35(18-34-23)28-25(43-31(39)21-14-8-3-9-15-21)24(42-30(38)20-12-6-2-7-13-20)22(41-28)16-40-29(37)19-10-4-1-5-11-19/h1-15,17-18,22,24-25,28H,16H2,(H,32,33,36)/t22-,24+,25+,28-/m1/s1 |
| InChIKey | HYIROYSRWYWYBO-FQFFBEATSA-N |
| XLogP | 3.33 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|