C34H30N4O8 — CID 135409656
[(2R,3R,4R,5R)-3,4-bis[(4-methylbenzoyl)oxy]-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 135409656) has the molecular formula C34H30N4O8 and a molecular weight of 622.63 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-bis[(4-methylbenzoyl)oxy]-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-bis[(4-methylbenzoyl)oxy]-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 135409656 |
| Molecular Formula | C34H30N4O8 |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-bis[(4-methylbenzoyl)oxy]-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]cnc43)[C@H](OC(=O)c3ccc(C)cc3)[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C34H30N4O8/c1-19-4-10-22(11-5-19)32(40)43-16-25-27(45-33(41)23-12-6-20(2)7-13-23)28(46-34(42)24-14-8-21(3)9-15-24)31(44-25)38-18-37-26-29(38)35-17-36-30(26)39/h4-15,17-18,25,27-28,31H,16H2,1-3H3,(H,35,36,39)/t25-,27-,28-,31-/m1/s1 |
| InChIKey | GCGMBRQBRLQAFP-QWOIFIOOSA-N |
| XLogP | 4.25 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|