C21H21N5O8 — CID 135978131
[(2R,3S,5R)-3,4-diacetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl benzoate (PubChem CID 135978131) has the molecular formula C21H21N5O8 and a molecular weight of 471.43 g/mol. Its IUPAC name is [(2R,3S,5R)-3,4-diacetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,5R)-3,4-diacetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 135978131 |
| Molecular Formula | C21H21N5O8 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | [(2R,3S,5R)-3,4-diacetyloxy-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)OC1[C@@H](OC(C)=O)[C@@H](COC(=O)c2ccccc2)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C21H21N5O8/c1-10(27)32-15-13(8-31-20(30)12-6-4-3-5-7-12)34-19(16(15)33-11(2)28)26-9-23-14-17(26)24-21(22)25-18(14)29/h3-7,9,13,15-16,19H,8H2,1-2H3,(H3,22,24,25,29)/t13-,15+,16?,19-/m1/s1 |
| InChIKey | WRUNEOPWXBVSPS-VXSJHCPZSA-N |
| XLogP | 0.32 |
| TPSA | 177.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|