C25H37N5O8 — CID 136649608
[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-di(pentanoyloxy)oxolan-2-yl]methyl pentanoate (PubChem CID 136649608) has the molecular formula C25H37N5O8 and a molecular weight of 535.60 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-di(pentanoyloxy)oxolan-2-yl]methyl pentanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-di(pentanoyloxy)oxolan-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 136649608 |
| Molecular Formula | C25H37N5O8 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-di(pentanoyloxy)oxolan-2-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](OC(=O)CCCC)[C@@H]1OC(=O)CCCC |
| InChI | InChI=1S/C25H37N5O8/c1-4-7-10-16(31)35-13-15-20(37-17(32)11-8-5-2)21(38-18(33)12-9-6-3)24(36-15)30-14-27-19-22(30)28-25(26)29-23(19)34/h14-15,20-21,24H,4-13H2,1-3H3,(H3,26,28,29,34)/t15-,20-,21-,24-/m1/s1 |
| InChIKey | BFZRLVOHJXJSIW-FKLNCEEKSA-N |
| XLogP | 2.54 |
| TPSA | 177.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|