C17H23N5O4 — CID 172874165
[4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-3-methylidenecyclopentyl] pentanoate (PubChem CID 172874165) has the molecular formula C17H23N5O4 and a molecular weight of 361.40 g/mol. Its IUPAC name is [4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-3-methylidenecyclopentyl] pentanoate.
| Compound Name | [4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-3-methylidenecyclopentyl] pentanoate |
|---|---|
| PubChem CID | 172874165 |
| Molecular Formula | C17H23N5O4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | [4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-3-methylidenecyclopentyl] pentanoate |
| SMILES | C=C1C(CO)C(OC(=O)CCCC)CC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C17H23N5O4/c1-3-4-5-13(24)26-12-6-11(9(2)10(12)7-23)22-8-19-14-15(22)20-17(18)21-16(14)25/h8,10-12,23H,2-7H2,1H3,(H3,18,20,21,25) |
| InChIKey | CGELUNGHRPNNAR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|