C23H35N5O4 — CID 170648120
[(1S,2R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-3-methylidenecyclopentyl] undecanoate (PubChem CID 170648120) has the molecular formula C23H35N5O4 and a molecular weight of 445.56 g/mol. Its IUPAC name is [(1S,2R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-3-methylidenecyclopentyl] undecanoate.
| Compound Name | [(1S,2R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-3-methylidenecyclopentyl] undecanoate |
|---|---|
| PubChem CID | 170648120 |
| Molecular Formula | C23H35N5O4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | [(1S,2R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-3-methylidenecyclopentyl] undecanoate |
| SMILES | C=C1[C@H](CO)[C@@H](OC(=O)CCCCCCCCCC)C[C@@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C23H35N5O4/c1-3-4-5-6-7-8-9-10-11-19(30)32-18-12-17(15(2)16(18)13-29)28-14-25-20-21(28)26-23(24)27-22(20)31/h14,16-18,29H,2-13H2,1H3,(H3,24,26,27,31)/t16-,17-,18-/m0/s1 |
| InChIKey | UHQOUWXSLBZZJN-BZSNNMDCSA-N |
| XLogP | 3.25 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|