C13H17N5O2 — CID 163868604
2-amino-9-[(3R,4S)-3-(hydroxymethyl)-4-methyl-2-methylidenecyclopentyl]-1H-purin-6-one (PubChem CID 163868604) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-amino-9-[(3R,4S)-3-(hydroxymethyl)-4-methyl-2-methylidenecyclopentyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(3R,4S)-3-(hydroxymethyl)-4-methyl-2-methylidenecyclopentyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 163868604 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-amino-9-[(3R,4S)-3-(hydroxymethyl)-4-methyl-2-methylidenecyclopentyl]-1H-purin-6-one |
| SMILES | C=C1C(n2cnc3c(=O)[nH]c(N)nc32)C[C@H](C)[C@H]1CO |
| InChI | InChI=1S/C13H17N5O2/c1-6-3-9(7(2)8(6)4-19)18-5-15-10-11(18)16-13(14)17-12(10)20/h5-6,8-9,19H,2-4H2,1H3,(H3,14,16,17,20)/t6-,8+,9?/m0/s1 |
| InChIKey | PIUVNLFQPCAFOG-DZESUTGNSA-N |
| XLogP | 0.45 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|