C14H21N5O2 — CID 143150519
2-amino-9-[3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one;ethane (PubChem CID 143150519) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-amino-9-[3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one;ethane.
| Compound Name | 2-amino-9-[3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one;ethane |
|---|---|
| PubChem CID | 143150519 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-amino-9-[3-(hydroxymethyl)-2-methylidenecyclopentyl]-1H-purin-6-one;ethane |
| SMILES | C=C1C(CO)CCC1n1cnc2c(=O)[nH]c(N)nc21.CC |
| InChI | InChI=1S/C12H15N5O2.C2H6/c1-6-7(4-18)2-3-8(6)17-5-14-9-10(17)15-12(13)16-11(9)19;1-2/h5,7-8,18H,1-4H2,(H3,13,15,16,19);1-2H3 |
| InChIKey | XGMNQJFYMKGVGI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|